C7H12N4 — CID 126557568
6,7-dimethyl-1,2,3,6-tetrahydropurine (PubChem CID 126557568) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 6,7-dimethyl-1,2,3,6-tetrahydropurine.
| Compound Name | 6,7-dimethyl-1,2,3,6-tetrahydropurine |
|---|---|
| PubChem CID | 126557568 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 6,7-dimethyl-1,2,3,6-tetrahydropurine |
| SMILES | CC1NCNc2ncn(C)c21 |
| InChI | InChI=1S/C7H12N4/c1-5-6-7(9-3-8-5)10-4-11(6)2/h4-5,8-9H,3H2,1-2H3 |
| InChIKey | AUSXXVSUVFNQLH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |