C19H42N4 — CID 126558925
1-N'-[(1R)-1-aminoethyl]-1-N-(1-aminopropan-2-yl)-2-cycloundecylpropane-1,1-diamine (PubChem CID 126558925) has the molecular formula C19H42N4 and a molecular weight of 326.57 g/mol. Its IUPAC name is 1-N'-[(1R)-1-aminoethyl]-1-N-(1-aminopropan-2-yl)-2-cycloundecylpropane-1,1-diamine.
| Compound Name | 1-N'-[(1R)-1-aminoethyl]-1-N-(1-aminopropan-2-yl)-2-cycloundecylpropane-1,1-diamine |
|---|---|
| PubChem CID | 126558925 |
| Molecular Formula | C19H42N4 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.34 |
| IUPAC Name | 1-N'-[(1R)-1-aminoethyl]-1-N-(1-aminopropan-2-yl)-2-cycloundecylpropane-1,1-diamine |
| SMILES | CC(CN)NC(N[C@H](C)N)C(C)C1CCCCCCCCCC1 |
| InChI | InChI=1S/C19H42N4/c1-15(14-20)22-19(23-17(3)21)16(2)18-12-10-8-6-4-5-7-9-11-13-18/h15-19,22-23H,4-14,20-21H2,1-3H3/t15?,16?,17-,19?/m1/s1 |
| InChIKey | NFVCYUOASPJSLC-APUKJBRXSA-N |
| XLogP | 3.31 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|