C19H18N4OS — CID 126559036
N-[3-(5-thiophen-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclohex-2-en-1-yl]prop-2-enamide (PubChem CID 126559036) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is N-[3-(5-thiophen-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclohex-2-en-1-yl]prop-2-enamide.
| Compound Name | N-[3-(5-thiophen-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclohex-2-en-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126559036 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[3-(5-thiophen-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclohex-2-en-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C=C(c2ncnc3[nH]cc(-c4cccs4)c23)CCC1 |
| InChI | InChI=1S/C19H18N4OS/c1-2-16(24)23-13-6-3-5-12(9-13)18-17-14(15-7-4-8-25-15)10-20-19(17)22-11-21-18/h2,4,7-11,13H,1,3,5-6H2,(H,23,24)(H,20,21,22) |
| InChIKey | VAQSCHBMTIJOBO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|