C37H32N2 — CID 126559816
1,1-dimethyl-9-[1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1H-inden-5-yl]-2-phenylpyrrolo[3,2-b]carbazole (PubChem CID 126559816) has the molecular formula C37H32N2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 1,1-dimethyl-9-[1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1H-inden-5-yl]-2-phenylpyrrolo[3,2-b]carbazole.
| Compound Name | 1,1-dimethyl-9-[1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1H-inden-5-yl]-2-phenylpyrrolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 126559816 |
| Molecular Formula | C37H32N2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 1,1-dimethyl-9-[1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1H-inden-5-yl]-2-phenylpyrrolo[3,2-b]carbazole |
| SMILES | C/C=C\C=C/C1=Cc2cc(-n3c4ccccc4c4cc5c(cc43)C(C)(C)C(c3ccccc3)=N5)ccc2C1C |
| InChI | InChI=1S/C37H32N2/c1-5-6-8-15-26-20-27-21-28(18-19-29(27)24(26)2)39-34-17-12-11-16-30(34)31-22-33-32(23-35(31)39)37(3,4)36(38-33)25-13-9-7-10-14-25/h5-24H,1-4H3/b6-5-,15-8- |
| InChIKey | YCOYDDQRJOBZFK-KZZFBBJTSA-N |
| XLogP | 9.83 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|