About (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine
(1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 126560327) has the molecular formula C12H18FNS
and a molecular weight of 227.35 g/mol. Its IUPAC name is (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 126560327 |
| Molecular Formula | C12H18FNS |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CS(C)(C)c1ccc(F)c2c1CC[C@H]2N |
| InChI | InChI=1S/C12H18FNS/c1-15(2,3)11-7-5-9(13)12-8(11)4-6-10(12)14/h5,7,10H,4,6,14H2,1-3H3/t10-/m1/s1 |
| InChIKey | WFVRVGSPUSCWKK-SNVBAGLBSA-N |
| XLogP | 2.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine (CID 126560327) is (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine is CS(C)(C)c1ccc(F)c2c1CC[C@H]2N.
What is the InChIKey of (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine?
The InChIKey is WFVRVGSPUSCWKK-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H18FNS/c1-15(2,3)11-7-5-9(13)12-8(11)4-6-10(12)14/h5,7,10H,4,6,14H2,1-3H3/t10-/m1/s1.
What are the key properties of (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine?
(1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine has a molecular weight of 227.35 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-7-fluoro-4-(trimethyl-λ4-sulfanyl)-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 126560327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).