About 5-bromo-4-fluoro-2,3-dihydro-1H-indene
5-bromo-4-fluoro-2,3-dihydro-1H-indene (PubChem CID 126560536) has the molecular formula C9H8BrF
and a molecular weight of 215.06 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-bromo-4-fluoro-2,3-dihydro-1H-indene |
| PubChem CID | 126560536 |
| Molecular Formula | C9H8BrF |
| Molecular Weight | 215.06 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 5-bromo-4-fluoro-2,3-dihydro-1H-indene |
| SMILES | Fc1c(Br)ccc2c1CCC2 |
| InChI | InChI=1S/C9H8BrF/c10-8-5-4-6-2-1-3-7(6)9(8)11/h4-5H,1-3H2 |
| InChIKey | JMXAUGGYHVFQBH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.06 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-bromo-4-fluoro-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-fluoro-2,3-dihydro-1H-indene?
The IUPAC name of 5-bromo-4-fluoro-2,3-dihydro-1H-indene (CID 126560536) is 5-bromo-4-fluoro-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-bromo-4-fluoro-2,3-dihydro-1H-indene?
The canonical SMILES for 5-bromo-4-fluoro-2,3-dihydro-1H-indene is Fc1c(Br)ccc2c1CCC2.
What is the InChIKey of 5-bromo-4-fluoro-2,3-dihydro-1H-indene?
The InChIKey is JMXAUGGYHVFQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF/c10-8-5-4-6-2-1-3-7(6)9(8)11/h4-5H,1-3H2.
What are the key properties of 5-bromo-4-fluoro-2,3-dihydro-1H-indene?
5-bromo-4-fluoro-2,3-dihydro-1H-indene has a molecular weight of 215.06 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-fluoro-2,3-dihydro-1H-indene is sourced from PubChem (CID 126560536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).