About 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine
5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine (PubChem CID 126560646) has the molecular formula C9H13FN2O2S
and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine |
| PubChem CID | 126560646 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine |
| SMILES | C[C@H](c1ncc(F)cn1)[C@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C9H13FN2O2S/c1-6(7(2)15(3,13)14)9-11-4-8(10)5-12-9/h4-7H,1-3H3/t6-,7-/m0/s1 |
| InChIKey | CUYVPKQIJHTKGQ-BQBZGAKWSA-N |
| XLogP | 1.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine?
The IUPAC name of 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine (CID 126560646) is 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine.
What is the SMILES notation for 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine?
The canonical SMILES for 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine is C[C@H](c1ncc(F)cn1)[C@H](C)S(C)(=O)=O.
What is the InChIKey of 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine?
The InChIKey is CUYVPKQIJHTKGQ-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H13FN2O2S/c1-6(7(2)15(3,13)14)9-11-4-8(10)5-12-9/h4-7H,1-3H3/t6-,7-/m0/s1.
What are the key properties of 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine?
5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine has a molecular weight of 232.28 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(2R,3S)-3-methylsulfonylbutan-2-yl]pyrimidine is sourced from PubChem (CID 126560646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).