C17H18F2N2O6S — CID 126561804
(2,4-difluorophenyl)-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone (PubChem CID 126561804) has the molecular formula C17H18F2N2O6S and a molecular weight of 416.40 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 126561804 |
| Molecular Formula | C17H18F2N2O6S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (2,4-difluorophenyl)-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(NC[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)s1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H18F2N2O6S/c18-7-1-2-8(9(19)3-7)13(23)12-5-21-17(28-12)20-4-10-14(24)16(26)15(25)11(6-22)27-10/h1-3,5,10-11,14-16,22,24-26H,4,6H2,(H,20,21)/t10-,11-,14-,15-,16-/m1/s1 |
| InChIKey | XLWMSYAJGOFMHG-JERLVFOGSA-N |
| XLogP | -0.09 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |