C23H26FN3O6S — CID 126561819
[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone (PubChem CID 126561819) has the molecular formula C23H26FN3O6S and a molecular weight of 491.54 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone.
| Compound Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 126561819 |
| Molecular Formula | C23H26FN3O6S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-[2-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylamino]-1,3-thiazol-5-yl]methanone |
| SMILES | Cc1cc(C(=O)c2cnc(NC[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)s2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O6S/c1-11-7-15(12(2)27(11)14-5-3-13(24)4-6-14)19(29)18-9-26-23(34-18)25-8-16-20(30)22(32)21(31)17(10-28)33-16/h3-7,9,16-17,20-22,28,30-32H,8,10H2,1-2H3,(H,25,26)/t16-,17-,20-,21-,22-/m1/s1 |
| InChIKey | VRTQOWKICMSJDZ-FXJJGOGXSA-N |
| XLogP | 1.18 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|