C15H25NO2 — CID 126562552
(4S)-4-tert-butyl-N,N,4,6-tetramethyl-5-oxohept-2-ynamide (PubChem CID 126562552) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (4S)-4-tert-butyl-N,N,4,6-tetramethyl-5-oxohept-2-ynamide.
| Compound Name | (4S)-4-tert-butyl-N,N,4,6-tetramethyl-5-oxohept-2-ynamide |
|---|---|
| PubChem CID | 126562552 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (4S)-4-tert-butyl-N,N,4,6-tetramethyl-5-oxohept-2-ynamide |
| SMILES | CC(C)C(=O)[C@](C)(C#CC(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-11(2)13(18)15(6,14(3,4)5)10-9-12(17)16(7)8/h11H,1-8H3/t15-/m0/s1 |
| InChIKey | QEAXKDPBFVKPIS-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|