C20H11BrN2O5S — CID 126562894
3-[(12-bromo-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl)amino]benzenesulfonic acid (PubChem CID 126562894) has the molecular formula C20H11BrN2O5S and a molecular weight of 471.29 g/mol. Its IUPAC name is 3-[(12-bromo-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl)amino]benzenesulfonic acid.
| Compound Name | 3-[(12-bromo-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 126562894 |
| Molecular Formula | C20H11BrN2O5S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | 3-[(12-bromo-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl)amino]benzenesulfonic acid |
| SMILES | O=C1c2ccccc2-c2onc3c(Br)cc(Nc4cccc(S(=O)(=O)O)c4)c1c23 |
| InChI | InChI=1S/C20H11BrN2O5S/c21-14-9-15(22-10-4-3-5-11(8-10)29(25,26)27)16-17-18(14)23-28-20(17)13-7-2-1-6-12(13)19(16)24/h1-9,22H,(H,25,26,27) |
| InChIKey | VEZDBQZEXNLECU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|