C18H22N2O6 — CID 126563858
(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[[2-oxo-4-[(Z)-prop-1-enyl]-1H-quinolin-7-yl]amino]hexanal (PubChem CID 126563858) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[[2-oxo-4-[(Z)-prop-1-enyl]-1H-quinolin-7-yl]amino]hexanal.
| Compound Name | (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[[2-oxo-4-[(Z)-prop-1-enyl]-1H-quinolin-7-yl]amino]hexanal |
|---|---|
| PubChem CID | 126563858 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-2-[[2-oxo-4-[(Z)-prop-1-enyl]-1H-quinolin-7-yl]amino]hexanal |
| SMILES | C/C=C\c1cc(=O)[nH]c2cc(N[C@H](C=O)[C@H](O)[C@@H](O)[C@@H](O)CO)ccc12 |
| InChI | InChI=1S/C18H22N2O6/c1-2-3-10-6-16(24)20-13-7-11(4-5-12(10)13)19-14(8-21)17(25)18(26)15(23)9-22/h2-8,14-15,17-19,22-23,25-26H,9H2,1H3,(H,20,24)/b3-2-/t14-,15+,17+,18+/m1/s1 |
| InChIKey | LRZKLWLRGJGFHN-MGHXXKNWSA-N |
| XLogP | -0.38 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|