C17H20N2O7 — CID 126563868
(2S,3S,4R,5S)-2-[(3-acetyl-2-oxo-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal (PubChem CID 126563868) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[(3-acetyl-2-oxo-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3S,4R,5S)-2-[(3-acetyl-2-oxo-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 126563868 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2S,3S,4R,5S)-2-[(3-acetyl-2-oxo-1H-quinolin-7-yl)amino]-3,4,5,6-tetrahydroxyhexanal |
| SMILES | CC(=O)c1cc2ccc(N[C@H](C=O)[C@H](O)[C@@H](O)[C@@H](O)CO)cc2[nH]c1=O |
| InChI | InChI=1S/C17H20N2O7/c1-8(22)11-4-9-2-3-10(5-12(9)19-17(11)26)18-13(6-20)15(24)16(25)14(23)7-21/h2-6,13-16,18,21,23-25H,7H2,1H3,(H,19,26)/t13-,14+,15+,16+/m1/s1 |
| InChIKey | QZRZYFYJQHAEMY-UGUYLWEFSA-N |
| XLogP | -1.21 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|