About N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide
N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide (PubChem CID 126564384) has the molecular formula C15H22FIN2O
and a molecular weight of 392.26 g/mol. Its IUPAC name is N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide.
Molecular Properties
| Compound Name | N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide |
| PubChem CID | 126564384 |
| Molecular Formula | C15H22FIN2O |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide |
| SMILES | Cc1cc(F)cc(C)c1NC(=O)C1CCCC[NH+]1C.[I-] |
| InChI | InChI=1S/C15H21FN2O.HI/c1-10-8-12(16)9-11(2)14(10)17-15(19)13-6-4-5-7-18(13)3;/h8-9,13H,4-7H2,1-3H3,(H,17,19);1H |
| InChIKey | QJZLRDUUGIHRRP-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide?
The IUPAC name of N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide (CID 126564384) is N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide.
What is the SMILES notation for N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide?
The canonical SMILES for N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide is Cc1cc(F)cc(C)c1NC(=O)C1CCCC[NH+]1C.[I-].
What is the InChIKey of N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide?
The InChIKey is QJZLRDUUGIHRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2O.HI/c1-10-8-12(16)9-11(2)14(10)17-15(19)13-6-4-5-7-18(13)3;/h8-9,13H,4-7H2,1-3H3,(H,17,19);1H.
What are the key properties of N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide?
N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide has a molecular weight of 392.26 g/mol, XLogP of -1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluoro-2,6-dimethylphenyl)-1-methylpiperidin-1-ium-2-carboxamide iodide is sourced from PubChem (CID 126564384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).