C23H20ClN5 — CID 126564427
7-(4-chlorophenyl)-1-methyl-9-(6-methyl-3-pyridinyl)-5,6-dihydrotriazolo[1,5-d][1,4]benzodiazepine (PubChem CID 126564427) has the molecular formula C23H20ClN5 and a molecular weight of 401.90 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-1-methyl-9-(6-methyl-3-pyridinyl)-5,6-dihydrotriazolo[1,5-d][1,4]benzodiazepine.
| Compound Name | 7-(4-chlorophenyl)-1-methyl-9-(6-methyl-3-pyridinyl)-5,6-dihydrotriazolo[1,5-d][1,4]benzodiazepine |
|---|---|
| PubChem CID | 126564427 |
| Molecular Formula | C23H20ClN5 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 7-(4-chlorophenyl)-1-methyl-9-(6-methyl-3-pyridinyl)-5,6-dihydrotriazolo[1,5-d][1,4]benzodiazepine |
| SMILES | Cc1ccc(-c2ccc3c(c2)N(c2ccc(Cl)cc2)CCn2nnc(C)c2-3)cn1 |
| InChI | InChI=1S/C23H20ClN5/c1-15-3-4-18(14-25-15)17-5-10-21-22(13-17)28(20-8-6-19(24)7-9-20)11-12-29-23(21)16(2)26-27-29/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | JPPYRYLQQXKOPP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|