About (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate
(7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate (PubChem CID 126564468) has the molecular formula C20H18N4O3
and a molecular weight of 362.39 g/mol. Its IUPAC name is (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate.
Molecular Properties
| Compound Name | (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate |
| PubChem CID | 126564468 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate |
| SMILES | CC(=O)OCc1nnn2c1-c1ccccc1N(Cc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C20H18N4O3/c1-14(25)27-13-17-20-16-9-5-6-10-18(16)23(11-15-7-3-2-4-8-15)19(26)12-24(20)22-21-17/h2-10H,11-13H2,1H3 |
| InChIKey | FBKGGGOXZXPGGT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate?
The IUPAC name of (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate (CID 126564468) is (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate.
What is the SMILES notation for (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate?
The canonical SMILES for (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate is CC(=O)OCc1nnn2c1-c1ccccc1N(Cc1ccccc1)C(=O)C2.
What is the InChIKey of (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate?
The InChIKey is FBKGGGOXZXPGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3/c1-14(25)27-13-17-20-16-9-5-6-10-18(16)23(11-15-7-3-2-4-8-15)19(26)12-24(20)22-21-17/h2-10H,11-13H2,1H3.
What are the key properties of (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate?
(7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate has a molecular weight of 362.39 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-benzyl-6-oxo-5H-triazolo[1,5-d][1,4]benzodiazepin-1-yl)methyl acetate is sourced from PubChem (CID 126564468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).