About CID 12656490
CID 12656490 (PubChem CID 12656490) has the molecular formula C2HF2
and a molecular weight of 63.03 g/mol.
Molecular Properties
| Compound Name | CID 12656490 |
| PubChem CID | 12656490 |
| Molecular Formula | C2HF2 |
| Molecular Weight | 63.03 g/mol |
| Exact Mass | 63.00 |
| IUPAC Name | — |
| SMILES | [CH]=C(F)F |
| InChI | InChI=1S/C2HF2/c1-2(3)4/h1H |
| InChIKey | YRZKPCLUFNEHRU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 63.03 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 12656490 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12656490?
The IUPAC name of CID 12656490 (CID 12656490) is not available.
What is the SMILES notation for CID 12656490?
The canonical SMILES for CID 12656490 is [CH]=C(F)F.
What is the InChIKey of CID 12656490?
The InChIKey is YRZKPCLUFNEHRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF2/c1-2(3)4/h1H.
What are the key properties of CID 12656490?
CID 12656490 has a molecular weight of 63.03 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12656490 is sourced from PubChem (CID 12656490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).