About 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene
2-fluoro-5-propan-2-yl-2,3-dihydrothiophene (PubChem CID 126565366) has the molecular formula C7H11FS
and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene |
| PubChem CID | 126565366 |
| Molecular Formula | C7H11FS |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene |
| SMILES | CC(C)C1=CCC(F)S1 |
| InChI | InChI=1S/C7H11FS/c1-5(2)6-3-4-7(8)9-6/h3,5,7H,4H2,1-2H3 |
| InChIKey | WKNZOKSEFLBCKA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene?
The IUPAC name of 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene (CID 126565366) is 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene.
What is the SMILES notation for 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene?
The canonical SMILES for 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene is CC(C)C1=CCC(F)S1.
What is the InChIKey of 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene?
The InChIKey is WKNZOKSEFLBCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FS/c1-5(2)6-3-4-7(8)9-6/h3,5,7H,4H2,1-2H3.
What are the key properties of 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene?
2-fluoro-5-propan-2-yl-2,3-dihydrothiophene has a molecular weight of 146.23 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-propan-2-yl-2,3-dihydrothiophene is sourced from PubChem (CID 126565366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).