C18H15F2N3O4S2 — CID 126565466
(3S)-4-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile (PubChem CID 126565466) has the molecular formula C18H15F2N3O4S2 and a molecular weight of 439.47 g/mol. Its IUPAC name is (3S)-4-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile.
| Compound Name | (3S)-4-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 126565466 |
| Molecular Formula | C18H15F2N3O4S2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (3S)-4-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
| SMILES | CN1C(=O)C23C[C@](C)(C#N)C(c4ccc5c(c4)OC(F)(F)O5)N2C(=O)C1(C)SS3 |
| InChI | InChI=1S/C18H15F2N3O4S2/c1-15(8-21)7-17-14(25)22(3)16(2,28-29-17)13(24)23(17)12(15)9-4-5-10-11(6-9)27-18(19,20)26-10/h4-6,12H,7H2,1-3H3/t12?,15-,16?,17?/m1/s1 |
| InChIKey | ZXTNYUBMCIBYKH-AYNFRXILSA-N |
| XLogP | 3.09 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|