About Bromodimethylsilane
Bromodimethylsilane (PubChem CID 12656553) has the molecular formula C2H6BrSi
and a molecular weight of 138.06 g/mol.
Molecular Properties
| Compound Name | Bromodimethylsilane |
| PubChem CID | 12656553 |
| Molecular Formula | C2H6BrSi |
| Molecular Weight | 138.06 g/mol |
| Exact Mass | 136.94 |
| IUPAC Name | — |
| SMILES | C[Si](C)Br |
| InChI | InChI=1S/C2H6BrSi/c1-4(2)3/h1-2H3 |
| InChIKey | KJAULXHDTVQHMZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.06 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze Bromodimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bromodimethylsilane?
The IUPAC name of Bromodimethylsilane (CID 12656553) is not available.
What is the SMILES notation for Bromodimethylsilane?
The canonical SMILES for Bromodimethylsilane is C[Si](C)Br.
What is the InChIKey of Bromodimethylsilane?
The InChIKey is KJAULXHDTVQHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6BrSi/c1-4(2)3/h1-2H3.
What are the key properties of Bromodimethylsilane?
Bromodimethylsilane has a molecular weight of 138.06 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Bromodimethylsilane is sourced from PubChem (CID 12656553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).