C19H21BrN2O5S — CID 126565543
methyl (3S,4S)-4-(5-bromo-2-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate (PubChem CID 126565543) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is methyl (3S,4S)-4-(5-bromo-2-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate.
| Compound Name | methyl (3S,4S)-4-(5-bromo-2-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate |
|---|---|
| PubChem CID | 126565543 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | methyl (3S,4S)-4-(5-bromo-2-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC23SC(C)(C(=O)N2[C@H]1c1cc(Br)ccc1OC)N(C)C3=O |
| InChI | InChI=1S/C19H21BrN2O5S/c1-17(16(25)27-5)9-19-15(24)21(3)18(2,28-19)14(23)22(19)13(17)11-8-10(20)6-7-12(11)26-4/h6-8,13H,9H2,1-5H3/t13-,17-,18?,19?/m0/s1 |
| InChIKey | DIXAWFZJESFOIZ-FFPGDZTESA-N |
| XLogP | 2.54 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |