C19H21N3O4S2 — CID 126565661
3-[7-[(1R)-1-(1,3-benzodioxol-4-yl)propyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile (PubChem CID 126565661) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[7-[(1R)-1-(1,3-benzodioxol-4-yl)propyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile.
| Compound Name | 3-[7-[(1R)-1-(1,3-benzodioxol-4-yl)propyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile |
|---|---|
| PubChem CID | 126565661 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-[7-[(1R)-1-(1,3-benzodioxol-4-yl)propyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile |
| SMILES | CC[C@H](c1cccc2c1OCO2)N1C(=O)C2(C)SSC1(CCC#N)C(=O)N2C |
| InChI | InChI=1S/C19H21N3O4S2/c1-4-13(12-7-5-8-14-15(12)26-11-25-14)22-16(23)18(2)21(3)17(24)19(22,28-27-18)9-6-10-20/h5,7-8,13H,4,6,9,11H2,1-3H3/t13-,18?,19?/m1/s1 |
| InChIKey | HNUJMRHKSSDNNB-XYJCDUHRSA-N |
| XLogP | 3.28 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|