C19H23FN2O4S2 — CID 126565718
methyl (2S,3S)-2-(4-fluorophenyl)-3,7,8-trimethyl-6,12-dioxo-9,10-dithia-1,7-diazabicyclo[6.3.1]dodecane-3-carboxylate (PubChem CID 126565718) has the molecular formula C19H23FN2O4S2 and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl (2S,3S)-2-(4-fluorophenyl)-3,7,8-trimethyl-6,12-dioxo-9,10-dithia-1,7-diazabicyclo[6.3.1]dodecane-3-carboxylate.
| Compound Name | methyl (2S,3S)-2-(4-fluorophenyl)-3,7,8-trimethyl-6,12-dioxo-9,10-dithia-1,7-diazabicyclo[6.3.1]dodecane-3-carboxylate |
|---|---|
| PubChem CID | 126565718 |
| Molecular Formula | C19H23FN2O4S2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl (2S,3S)-2-(4-fluorophenyl)-3,7,8-trimethyl-6,12-dioxo-9,10-dithia-1,7-diazabicyclo[6.3.1]dodecane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC(=O)N(C)C2(C)SSCN(C2=O)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O4S2/c1-18(17(25)26-4)10-9-14(23)21(3)19(2)16(24)22(11-27-28-19)15(18)12-5-7-13(20)8-6-12/h5-8,15H,9-11H2,1-4H3/t15-,18-,19?/m0/s1 |
| InChIKey | DYNNEFWYHDNYRM-SIYBWXAISA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|