C26H36F3N5OS — CID 126565861
4-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexan-1-ol (PubChem CID 126565861) has the molecular formula C26H36F3N5OS and a molecular weight of 523.67 g/mol. Its IUPAC name is 4-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126565861 |
| Molecular Formula | C26H36F3N5OS |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 4-[5-[3-[(3aR,6aR)-3a-methyl-1-[4-(trifluoromethyl)phenyl]-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexan-1-ol |
| SMILES | Cn1c(SCCCN2C[C@@H]3N(c4ccc(C(F)(F)F)cc4)CC[C@]3(C)C2)nnc1C1CCC(O)CC1 |
| InChI | InChI=1S/C26H36F3N5OS/c1-25-12-14-34(20-8-6-19(7-9-20)26(27,28)29)22(25)16-33(17-25)13-3-15-36-24-31-30-23(32(24)2)18-4-10-21(35)11-5-18/h6-9,18,21-22,35H,3-5,10-17H2,1-2H3/t18?,21?,22-,25+/m0/s1 |
| InChIKey | SJQWQAHRTHBPAE-OURWBUIQSA-N |
| XLogP | 4.94 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|