C11H22N2 — CID 126565924
(3aR,7aS)-1,3a,6,7a-tetramethyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 126565924) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (3aR,7aS)-1,3a,6,7a-tetramethyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | (3aR,7aS)-1,3a,6,7a-tetramethyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 126565924 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (3aR,7aS)-1,3a,6,7a-tetramethyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CC[C@]2(C)CCN(C)[C@]2(C)C1 |
| InChI | InChI=1S/C11H22N2/c1-10-5-7-12(3)9-11(10,2)13(4)8-6-10/h5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | JZRCHKMZUGSBIY-GHMZBOCLSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |