C18H19F2N3O4 — CID 126565988
(3R,7S,8aS)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-hydroxy-2,3,7-trimethyl-1-oxo-4,6,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 126565988) has the molecular formula C18H19F2N3O4 and a molecular weight of 379.36 g/mol. Its IUPAC name is (3R,7S,8aS)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-hydroxy-2,3,7-trimethyl-1-oxo-4,6,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3R,7S,8aS)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-hydroxy-2,3,7-trimethyl-1-oxo-4,6,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 126565988 |
| Molecular Formula | C18H19F2N3O4 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (3R,7S,8aS)-6-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-hydroxy-2,3,7-trimethyl-1-oxo-4,6,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | C[C@@H]1C(O)N2C(c3ccc4c(c3)OC(F)(F)O4)[C@@](C)(C#N)C[C@H]2C(=O)N1C |
| InChI | InChI=1S/C18H19F2N3O4/c1-9-15(24)23-11(16(25)22(9)3)7-17(2,8-21)14(23)10-4-5-12-13(6-10)27-18(19,20)26-12/h4-6,9,11,14-15,24H,7H2,1-3H3/t9-,11+,14?,15?,17-/m1/s1 |
| InChIKey | HMFZKVPTTVCCQT-UDBDEICJSA-N |
| XLogP | 1.83 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |