C19H29N5OS — CID 126566080
4-[4-methyl-5-[3-(3-methyl-4-propylpyrrolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one (PubChem CID 126566080) has the molecular formula C19H29N5OS and a molecular weight of 375.54 g/mol. Its IUPAC name is 4-[4-methyl-5-[3-(3-methyl-4-propylpyrrolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one.
| Compound Name | 4-[4-methyl-5-[3-(3-methyl-4-propylpyrrolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126566080 |
| Molecular Formula | C19H29N5OS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 4-[4-methyl-5-[3-(3-methyl-4-propylpyrrolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
| SMILES | CCCC1CN(CCCSc2nnc(-c3cc[nH]c(=O)c3)n2C)CC1C |
| InChI | InChI=1S/C19H29N5OS/c1-4-6-16-13-24(12-14(16)2)9-5-10-26-19-22-21-18(23(19)3)15-7-8-20-17(25)11-15/h7-8,11,14,16H,4-6,9-10,12-13H2,1-3H3,(H,20,25) |
| InChIKey | LDNBESDEMVLYDC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|