C32H28F2N12O9P+ — CID 126567745
bis[[(2R,3R,4S,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy]-oxophosphanium (PubChem CID 126567745) has the molecular formula C32H28F2N12O9P+ and a molecular weight of 793.62 g/mol. Its IUPAC name is bis[[(2R,3R,4S,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy]-oxophosphanium.
| Compound Name | bis[[(2R,3R,4S,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy]-oxophosphanium |
|---|---|
| PubChem CID | 126567745 |
| Molecular Formula | C32H28F2N12O9P+ |
| Molecular Weight | 793.62 g/mol |
| Exact Mass | 793.18 |
| IUPAC Name | bis[[(2R,3R,4S,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy]-oxophosphanium |
| SMILES | O=C(Nc1ncnc2c1nnn2[C@@H]1O[C@H](CO)[C@@H](O[P+](=O)O[C@H]2[C@H](F)[C@H](n3nnc4c(NC(=O)c5ccccc5)ncnc43)O[C@@H]2CO)[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C32H27F2N12O9P/c33-19-23(17(11-47)52-31(19)45-27-21(41-43-45)25(35-13-37-27)39-29(49)15-7-3-1-4-8-15)54-56(51)55-24-18(12-48)53-32(20(24)34)46-28-22(42-44-46)26(36-14-38-28)40-30(50)16-9-5-2-6-10-16/h1-10,13-14,17-20,23-24,31-32,47-48H,11-12H2,(H-,35,36,37,38,39,40,43,44,49,50)/p+1/t17-,18-,19+,20+,23-,24-,31-,32-/m1/s1 |
| InChIKey | MAOHOHDHDMUHFU-PDWPOGSOSA-O |
| XLogP | 1.84 |
| TPSA | 265.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|