C23H24N4O3S — CID 126568570
(E)-3-[4-(2-methoxy-1,3-thiazol-5-yl)-3-pyridinyl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide (PubChem CID 126568570) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is (E)-3-[4-(2-methoxy-1,3-thiazol-5-yl)-3-pyridinyl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-methoxy-1,3-thiazol-5-yl)-3-pyridinyl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126568570 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (E)-3-[4-(2-methoxy-1,3-thiazol-5-yl)-3-pyridinyl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide |
| SMILES | COc1ncc(-c2ccncc2/C=C/C(=O)Nc2ccc(CN3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C23H24N4O3S/c1-29-23-25-15-21(31-23)20-8-9-24-14-18(20)4-7-22(28)26-19-5-2-17(3-6-19)16-27-10-12-30-13-11-27/h2-9,14-15H,10-13,16H2,1H3,(H,26,28)/b7-4+ |
| InChIKey | MEFSUICXZJQPFL-QPJJXVBHSA-N |
| XLogP | 3.70 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|