C23H23F2N5O — CID 126568827
(E)-N-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 126568827) has the molecular formula C23H23F2N5O and a molecular weight of 423.47 g/mol. Its IUPAC name is (E)-N-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 126568827 |
| Molecular Formula | C23H23F2N5O |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (E)-N-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | Cn1cc(-c2ccncc2/C=C/C(=O)Nc2ccc(CN3CCC(F)(F)C3)cc2)cn1 |
| InChI | InChI=1S/C23H23F2N5O/c1-29-15-19(13-27-29)21-8-10-26-12-18(21)4-7-22(31)28-20-5-2-17(3-6-20)14-30-11-9-23(24,25)16-30/h2-8,10,12-13,15H,9,11,14,16H2,1H3,(H,28,31)/b7-4+ |
| InChIKey | LUSRSUWSGVIMEM-QPJJXVBHSA-N |
| XLogP | 3.97 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|