C9H14N4 — CID 126569116
5-methyl-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine (PubChem CID 126569116) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-methyl-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-methyl-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 126569116 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-methyl-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine |
| SMILES | C=CCN(CC=C)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C9H14N4/c1-4-6-13(7-5-2)9-10-8(3)11-12-9/h4-5H,1-2,6-7H2,3H3,(H,10,11,12) |
| InChIKey | XODGRJDEFNVGEV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|