C13H10Li2O9S3 — CID 126569166
dilithium;4-prop-1-en-2-yl-3-sulfonaphthalene-1,2-disulfonate (PubChem CID 126569166) has the molecular formula C13H10Li2O9S3 and a molecular weight of 420.30 g/mol. Its IUPAC name is dilithium;4-prop-1-en-2-yl-3-sulfonaphthalene-1,2-disulfonate.
| Compound Name | dilithium;4-prop-1-en-2-yl-3-sulfonaphthalene-1,2-disulfonate |
|---|---|
| PubChem CID | 126569166 |
| Molecular Formula | C13H10Li2O9S3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | dilithium;4-prop-1-en-2-yl-3-sulfonaphthalene-1,2-disulfonate |
| SMILES | C=C(C)c1c(S(=O)(=O)O)c(S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2ccccc12.[Li+].[Li+] |
| InChI | InChI=1S/C13H12O9S3.2Li/c1-7(2)10-8-5-3-4-6-9(8)11(23(14,15)16)13(25(20,21)22)12(10)24(17,18)19;;/h3-6H,1H2,2H3,(H,14,15,16)(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | ICJRCMJZVNMJPC-UHFFFAOYSA-L |
| XLogP | -5.06 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | -5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|