About trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile
trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile (PubChem CID 12656927) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile |
| PubChem CID | 12656927 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile |
| SMILES | N#C[C@@H]1CCCC[C@H]1C#N |
| InChI | InChI=1S/C8H10N2/c9-5-7-3-1-2-4-8(7)6-10/h7-8H,1-4H2/t7-,8-/m0/s1 |
| InChIKey | HJUWHGADIVLYKV-YUMQZZPRSA-N |
| XLogP | 1.84 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile?
The IUPAC name of trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile (CID 12656927) is trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile.
What is the SMILES notation for trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile?
The canonical SMILES for trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile is N#C[C@@H]1CCCC[C@H]1C#N.
What is the InChIKey of trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile?
The InChIKey is HJUWHGADIVLYKV-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H10N2/c9-5-7-3-1-2-4-8(7)6-10/h7-8H,1-4H2/t7-,8-/m0/s1.
What are the key properties of trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile?
trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile has a molecular weight of 134.18 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-cyclohexane-1,2-dicarbonitrile is sourced from PubChem (CID 12656927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).