C10H10ClF3N2O — CID 126569320
7-chloro-1-methyl-2-(2,2,2-trifluoroethyl)-2,3-dihydropyrido[3,4-b][1,4]oxazine (PubChem CID 126569320) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 7-chloro-1-methyl-2-(2,2,2-trifluoroethyl)-2,3-dihydropyrido[3,4-b][1,4]oxazine.
| Compound Name | 7-chloro-1-methyl-2-(2,2,2-trifluoroethyl)-2,3-dihydropyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 126569320 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 7-chloro-1-methyl-2-(2,2,2-trifluoroethyl)-2,3-dihydropyrido[3,4-b][1,4]oxazine |
| SMILES | CN1c2cc(Cl)ncc2OCC1CC(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O/c1-16-6(3-10(12,13)14)5-17-8-4-15-9(11)2-7(8)16/h2,4,6H,3,5H2,1H3 |
| InChIKey | QAKDSZMAEHWBHJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|