C23H32N6O — CID 126569552
4-[2-(butylamino)-5-[4-(methylaminomethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 126569552) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[4-(methylaminomethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[4-(methylaminomethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126569552 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 4-[2-(butylamino)-5-[4-(methylaminomethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(CNC)cc3)nc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C23H32N6O/c1-3-4-13-25-23-26-15-20-21(17-7-5-16(6-8-17)14-24-2)27-22(29(20)28-23)18-9-11-19(30)12-10-18/h5-8,15,18-19,24,30H,3-4,9-14H2,1-2H3,(H,25,28) |
| InChIKey | MLHFPKURZKADEF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|