C28H40N6O — CID 126569578
4-[2-(butylamino)-5-[4-[(cyclohexylamino)methyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 126569578) has the molecular formula C28H40N6O and a molecular weight of 476.67 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[4-[(cyclohexylamino)methyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[4-[(cyclohexylamino)methyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126569578 |
| Molecular Formula | C28H40N6O |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 4-[2-(butylamino)-5-[4-[(cyclohexylamino)methyl]phenyl]imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(CNC4CCCCC4)cc3)nc(C3CCC(O)CC3)n2n1 |
| InChI | InChI=1S/C28H40N6O/c1-2-3-17-29-28-31-19-25-26(32-27(34(25)33-28)22-13-15-24(35)16-14-22)21-11-9-20(10-12-21)18-30-23-7-5-4-6-8-23/h9-12,19,22-24,30,35H,2-8,13-18H2,1H3,(H,29,33) |
| InChIKey | LBFOYYYOENDKSM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|