C30H24F6O10S2 — CID 126569728
tert-butyl 9',9'-dimethyl-1-oxo-2',7'-bis(trifluoromethylsulfonyloxy)spiro[2-benzofuran-3,10'-anthracene]-5-carboxylate (PubChem CID 126569728) has the molecular formula C30H24F6O10S2 and a molecular weight of 722.63 g/mol. Its IUPAC name is tert-butyl 9',9'-dimethyl-1-oxo-2',7'-bis(trifluoromethylsulfonyloxy)spiro[2-benzofuran-3,10'-anthracene]-5-carboxylate.
| Compound Name | tert-butyl 9',9'-dimethyl-1-oxo-2',7'-bis(trifluoromethylsulfonyloxy)spiro[2-benzofuran-3,10'-anthracene]-5-carboxylate |
|---|---|
| PubChem CID | 126569728 |
| Molecular Formula | C30H24F6O10S2 |
| Molecular Weight | 722.63 g/mol |
| Exact Mass | 722.07 |
| IUPAC Name | tert-butyl 9',9'-dimethyl-1-oxo-2',7'-bis(trifluoromethylsulfonyloxy)spiro[2-benzofuran-3,10'-anthracene]-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(OS(=O)(=O)C(F)(F)F)cc2C(C)(C)c2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C30H24F6O10S2/c1-26(2,3)43-24(37)15-6-9-18-21(12-15)28(44-25(18)38)19-10-7-16(45-47(39,40)29(31,32)33)13-22(19)27(4,5)23-14-17(8-11-20(23)28)46-48(41,42)30(34,35)36/h6-14H,1-5H3 |
| InChIKey | FESIZSWHANSJOO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|