C19H22F3N3O6S — CID 126570091
tert-butyl 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 126570091) has the molecular formula C19H22F3N3O6S and a molecular weight of 477.46 g/mol. Its IUPAC name is tert-butyl 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 126570091 |
| Molecular Formula | C19H22F3N3O6S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | tert-butyl 2-(4-methoxyphenyl)-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | COc1ccc(-n2nc3c(c2OS(=O)(=O)C(F)(F)F)CN(C(=O)OC(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C19H22F3N3O6S/c1-18(2,3)30-17(26)24-10-9-15-14(11-24)16(31-32(27,28)19(20,21)22)25(23-15)12-5-7-13(29-4)8-6-12/h5-8H,9-11H2,1-4H3 |
| InChIKey | FVKANDDYAYPUQY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|