C18H32N2 — CID 126570135
(1E,3E)-1-N-(cyclohexen-1-ylmethyl)-3-N-pentan-2-ylhexa-1,3-diene-1,3-diamine (PubChem CID 126570135) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (1E,3E)-1-N-(cyclohexen-1-ylmethyl)-3-N-pentan-2-ylhexa-1,3-diene-1,3-diamine.
| Compound Name | (1E,3E)-1-N-(cyclohexen-1-ylmethyl)-3-N-pentan-2-ylhexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 126570135 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (1E,3E)-1-N-(cyclohexen-1-ylmethyl)-3-N-pentan-2-ylhexa-1,3-diene-1,3-diamine |
| SMILES | CC/C=C(\C=C\NCC1=CCCCC1)NC(C)CCC |
| InChI | InChI=1S/C18H32N2/c1-4-9-16(3)20-18(10-5-2)13-14-19-15-17-11-7-6-8-12-17/h10-11,13-14,16,19-20H,4-9,12,15H2,1-3H3/b14-13+,18-10+ |
| InChIKey | CMTNUJGTLQQCJI-MXWNVFFBSA-N |
| XLogP | 4.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|