About 3-ethenylideneimidazo[1,2-a]pyridin-2-one
3-ethenylideneimidazo[1,2-a]pyridin-2-one (PubChem CID 126570213) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 3-ethenylideneimidazo[1,2-a]pyridin-2-one.
Molecular Properties
| Compound Name | 3-ethenylideneimidazo[1,2-a]pyridin-2-one |
| PubChem CID | 126570213 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 3-ethenylideneimidazo[1,2-a]pyridin-2-one |
| SMILES | C=C=C1C(=O)N=C2C=CC=CN12 |
| InChI | InChI=1S/C9H6N2O/c1-2-7-9(12)10-8-5-3-4-6-11(7)8/h3-6H,1H2 |
| InChIKey | BVNUCKJNUZSFEC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylideneimidazo[1,2-a]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylideneimidazo[1,2-a]pyridin-2-one?
The IUPAC name of 3-ethenylideneimidazo[1,2-a]pyridin-2-one (CID 126570213) is 3-ethenylideneimidazo[1,2-a]pyridin-2-one.
What is the SMILES notation for 3-ethenylideneimidazo[1,2-a]pyridin-2-one?
The canonical SMILES for 3-ethenylideneimidazo[1,2-a]pyridin-2-one is C=C=C1C(=O)N=C2C=CC=CN12.
What is the InChIKey of 3-ethenylideneimidazo[1,2-a]pyridin-2-one?
The InChIKey is BVNUCKJNUZSFEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-2-7-9(12)10-8-5-3-4-6-11(7)8/h3-6H,1H2.
What are the key properties of 3-ethenylideneimidazo[1,2-a]pyridin-2-one?
3-ethenylideneimidazo[1,2-a]pyridin-2-one has a molecular weight of 158.16 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylideneimidazo[1,2-a]pyridin-2-one is sourced from PubChem (CID 126570213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).