About 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole
5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole (PubChem CID 126570373) has the molecular formula C8H13NOS2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole |
| PubChem CID | 126570373 |
| Molecular Formula | C8H13NOS2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1ncc(C(C)SS)o1 |
| InChI | InChI=1S/C8H13NOS2/c1-5(2)8-9-4-7(10-8)6(3)12-11/h4-6,11H,1-3H3 |
| InChIKey | NWGXUDIEONWDHE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole?
The IUPAC name of 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole (CID 126570373) is 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole.
What is the SMILES notation for 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole?
The canonical SMILES for 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole is CC(C)c1ncc(C(C)SS)o1.
What is the InChIKey of 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole?
The InChIKey is NWGXUDIEONWDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS2/c1-5(2)8-9-4-7(10-8)6(3)12-11/h4-6,11H,1-3H3.
What are the key properties of 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole?
5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole has a molecular weight of 203.33 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(disulfanyl)ethyl]-2-propan-2-yl-1,3-oxazole is sourced from PubChem (CID 126570373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).