About 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide
3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide (PubChem CID 126570443) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide |
| PubChem CID | 126570443 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide |
| SMILES | COONC(CC1=CCCC=C1)C(N)=O |
| InChI | InChI=1S/C10H16N2O3/c1-14-15-12-9(10(11)13)7-8-5-3-2-4-6-8/h3,5-6,9,12H,2,4,7H2,1H3,(H2,11,13) |
| InChIKey | YBAQLBDOFRTPOC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide (CID 126570443) is 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide is COONC(CC1=CCCC=C1)C(N)=O.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide?
The InChIKey is YBAQLBDOFRTPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-14-15-12-9(10(11)13)7-8-5-3-2-4-6-8/h3,5-6,9,12H,2,4,7H2,1H3,(H2,11,13).
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide?
3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide has a molecular weight of 212.25 g/mol, XLogP of 0.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-2-(methylperoxyamino)propanamide is sourced from PubChem (CID 126570443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).