C20H26N4O4S3 — CID 126571539
(8S,11R)-8-propan-2-yl-11-(4-sulfanylbutyl)-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),4,16(19)-tetraene-6,9,13-trione (PubChem CID 126571539) has the molecular formula C20H26N4O4S3 and a molecular weight of 482.65 g/mol. Its IUPAC name is (8S,11R)-8-propan-2-yl-11-(4-sulfanylbutyl)-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),4,16(19)-tetraene-6,9,13-trione.
| Compound Name | (8S,11R)-8-propan-2-yl-11-(4-sulfanylbutyl)-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),4,16(19)-tetraene-6,9,13-trione |
|---|---|
| PubChem CID | 126571539 |
| Molecular Formula | C20H26N4O4S3 |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (8S,11R)-8-propan-2-yl-11-(4-sulfanylbutyl)-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),4,16(19)-tetraene-6,9,13-trione |
| SMILES | CC(C)[C@@H]1NC(=O)c2csc(n2)-c2csc(n2)CNC(=O)C[C@@H](CCCCS)OC1=O |
| InChI | InChI=1S/C20H26N4O4S3/c1-11(2)17-20(27)28-12(5-3-4-6-29)7-15(25)21-8-16-22-14(10-30-16)19-23-13(9-31-19)18(26)24-17/h9-12,17,29H,3-8H2,1-2H3,(H,21,25)(H,24,26)/t12-,17+/m1/s1 |
| InChIKey | OBVRUNGYAMIEBD-PXAZEXFGSA-N |
| XLogP | 3.05 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|