C35H40BrN3O6 — CID 126572014
2-[2-(3-bromophenyl)-7,8-dimethyl-5-[4-methyl-4-[2-(2-phenylmethoxypropoxy)ethoxy]piperidin-1-yl]imidazo[1,2-a]pyridin-6-yl]-2-oxoacetic acid (PubChem CID 126572014) has the molecular formula C35H40BrN3O6 and a molecular weight of 678.62 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-7,8-dimethyl-5-[4-methyl-4-[2-(2-phenylmethoxypropoxy)ethoxy]piperidin-1-yl]imidazo[1,2-a]pyridin-6-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-(3-bromophenyl)-7,8-dimethyl-5-[4-methyl-4-[2-(2-phenylmethoxypropoxy)ethoxy]piperidin-1-yl]imidazo[1,2-a]pyridin-6-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 126572014 |
| Molecular Formula | C35H40BrN3O6 |
| Molecular Weight | 678.62 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | 2-[2-(3-bromophenyl)-7,8-dimethyl-5-[4-methyl-4-[2-(2-phenylmethoxypropoxy)ethoxy]piperidin-1-yl]imidazo[1,2-a]pyridin-6-yl]-2-oxoacetic acid |
| SMILES | Cc1c(C(=O)C(=O)O)c(N2CCC(C)(OCCOCC(C)OCc3ccccc3)CC2)n2cc(-c3cccc(Br)c3)nc2c1C |
| InChI | InChI=1S/C35H40BrN3O6/c1-23(44-22-26-9-6-5-7-10-26)21-43-17-18-45-35(4)13-15-38(16-14-35)33-30(31(40)34(41)42)24(2)25(3)32-37-29(20-39(32)33)27-11-8-12-28(36)19-27/h5-12,19-20,23H,13-18,21-22H2,1-4H3,(H,41,42) |
| InChIKey | MYALEFKGGXSHGD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|