C6H5Br2NO — CID 126572034
3,5-dibromo-2-methyl-1H-pyridin-4-one (PubChem CID 126572034) has the molecular formula C6H5Br2NO and a molecular weight of 266.92 g/mol. Its IUPAC name is 3,5-dibromo-2-methyl-1H-pyridin-4-one.
| Compound Name | 3,5-dibromo-2-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 126572034 |
| Molecular Formula | C6H5Br2NO |
| Molecular Weight | 266.92 g/mol |
| Exact Mass | 264.87 |
| IUPAC Name | 3,5-dibromo-2-methyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]cc(Br)c(=O)c1Br |
| InChI | InChI=1S/C6H5Br2NO/c1-3-5(8)6(10)4(7)2-9-3/h2H,1H3,(H,9,10) |
| InChIKey | OERMVCIHRNBGQT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.92 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |