About disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate
disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate (PubChem CID 126572414) has the molecular formula C14H24Na2O7S
and a molecular weight of 382.39 g/mol. Its IUPAC name is disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate.
Molecular Properties
| Compound Name | disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate |
| PubChem CID | 126572414 |
| Molecular Formula | C14H24Na2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate |
| SMILES | CCC(CC)CCC(CC)C(CC(=O)[O-])(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C14H26O7S.2Na/c1-4-10(5-2)7-8-11(6-3)14(13(17)18,9-12(15)16)22(19,20)21;;/h10-11H,4-9H2,1-3H3,(H,15,16)(H,17,18)(H,19,20,21);;/q;2*+1/p-2 |
| InChIKey | HHLZMIKLKBTDKP-UHFFFAOYSA-L |
| XLogP | -6.25 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate?
The IUPAC name of disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate (CID 126572414) is disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate.
What is the SMILES notation for disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate?
The canonical SMILES for disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate is CCC(CC)CCC(CC)C(CC(=O)[O-])(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+].
What is the InChIKey of disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate?
The InChIKey is HHLZMIKLKBTDKP-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H26O7S.2Na/c1-4-10(5-2)7-8-11(6-3)14(13(17)18,9-12(15)16)22(19,20)21;;/h10-11H,4-9H2,1-3H3,(H,15,16)(H,17,18)(H,19,20,21);;/q;2*+1/p-2.
What are the key properties of disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate?
disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate has a molecular weight of 382.39 g/mol, XLogP of -6.25, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-(6-ethyloctan-3-yl)-2-sulfobutanedioate is sourced from PubChem (CID 126572414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).