C10H12BrF3N2 — CID 126572488
4-bromo-2-N-(3,3,3-trifluoro-2-methylpropyl)benzene-1,2-diamine (PubChem CID 126572488) has the molecular formula C10H12BrF3N2 and a molecular weight of 297.12 g/mol. Its IUPAC name is 4-bromo-2-N-(3,3,3-trifluoro-2-methylpropyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(3,3,3-trifluoro-2-methylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 126572488 |
| Molecular Formula | C10H12BrF3N2 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-bromo-2-N-(3,3,3-trifluoro-2-methylpropyl)benzene-1,2-diamine |
| SMILES | CC(CNc1cc(Br)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2/c1-6(10(12,13)14)5-16-9-4-7(11)2-3-8(9)15/h2-4,6,16H,5,15H2,1H3 |
| InChIKey | NQXPSMUQXRQTOI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|