About 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole
6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole (PubChem CID 126572494) has the molecular formula C17H21BrF2N2O
and a molecular weight of 387.27 g/mol. Its IUPAC name is 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole.
Molecular Properties
| Compound Name | 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole |
| PubChem CID | 126572494 |
| Molecular Formula | C17H21BrF2N2O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole |
| SMILES | COC(C)Cn1c(C2CCC(F)(F)CC2)nc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H21BrF2N2O/c1-11(23-2)10-22-15-9-13(18)3-4-14(15)21-16(22)12-5-7-17(19,20)8-6-12/h3-4,9,11-12H,5-8,10H2,1-2H3 |
| InChIKey | RILJFCAEJJPWSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole?
The IUPAC name of 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole (CID 126572494) is 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole.
What is the SMILES notation for 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole?
The canonical SMILES for 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole is COC(C)Cn1c(C2CCC(F)(F)CC2)nc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole?
The InChIKey is RILJFCAEJJPWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrF2N2O/c1-11(23-2)10-22-15-9-13(18)3-4-14(15)21-16(22)12-5-7-17(19,20)8-6-12/h3-4,9,11-12H,5-8,10H2,1-2H3.
What are the key properties of 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole?
6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole has a molecular weight of 387.27 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(4,4-difluorocyclohexyl)-1-(2-methoxypropyl)benzimidazole is sourced from PubChem (CID 126572494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).