C16H18F3N3O — CID 126572575
5-[4-amino-3-(3,3,3-trifluoropropylamino)phenyl]-1,3-dimethylpyridin-2-one (PubChem CID 126572575) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is 5-[4-amino-3-(3,3,3-trifluoropropylamino)phenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[4-amino-3-(3,3,3-trifluoropropylamino)phenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 126572575 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-[4-amino-3-(3,3,3-trifluoropropylamino)phenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccc(N)c(NCCC(F)(F)F)c2)cn(C)c1=O |
| InChI | InChI=1S/C16H18F3N3O/c1-10-7-12(9-22(2)15(10)23)11-3-4-13(20)14(8-11)21-6-5-16(17,18)19/h3-4,7-9,21H,5-6,20H2,1-2H3 |
| InChIKey | SGWUFNODNZEWPF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|