About 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone
2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone (PubChem CID 1265732) has the molecular formula C23H18N2OS
and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone |
| PubChem CID | 1265732 |
| Molecular Formula | C23H18N2OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone |
| SMILES | O=C(Cn1c(-c2ccccc2)c(-c2ccccc2)[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C23H18N2OS/c26-20(17-10-4-1-5-11-17)16-25-22(19-14-8-3-9-15-19)21(24-23(25)27)18-12-6-2-7-13-18/h1-15H,16H2,(H,24,27) |
| InChIKey | FDYTZUWLDOIJEA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone?
The IUPAC name of 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone (CID 1265732) is 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone.
What is the SMILES notation for 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone?
The canonical SMILES for 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone is O=C(Cn1c(-c2ccccc2)c(-c2ccccc2)[nH]c1=S)c1ccccc1.
What is the InChIKey of 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone?
The InChIKey is FDYTZUWLDOIJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2OS/c26-20(17-10-4-1-5-11-17)16-25-22(19-14-8-3-9-15-19)21(24-23(25)27)18-12-6-2-7-13-18/h1-15H,16H2,(H,24,27).
What are the key properties of 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone?
2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone has a molecular weight of 370.48 g/mol, XLogP of 5.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diphenyl-2-sulfanylidene-1H-imidazol-3-yl)-1-phenylethanone is sourced from PubChem (CID 1265732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).